Products 1858202-49-9
CAS 1858202-49-9 is the registry number for (4-(Benzo(b)thiophen-3-yl)phenyl)methanol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
[4-(1-benzothiophen-3-yl)phenyl]methanol (CAS 1858202-49-9) is a chemical compound with the molecular formula C15H12OS and a molecular weight of 240.3 g/mol. IUPAC name: [4-(1-benzothiophen-3-yl)phenyl]methanol. InChIKey: JRRWGIRGVYGHKI-UHFFFAOYSA-N.
| Molecular formula | C15H12OS |
|---|---|
| Molecular weight | 240.3 g/mol |
| IUPAC name | [4-(1-benzothiophen-3-yl)phenyl]methanol |
| InChIKey | JRRWGIRGVYGHKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)C3=CC=C(C=C3)CO |
Computed by PubChem (NCBI)