CAS 73149-92-5 is the registry number for 5-Phenylsulfanyl-indan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-phenylsulfanyl-2,3-dihydroinden-1-one (CAS 73149-92-5) is a chemical compound with the molecular formula C15H12OS and a molecular weight of 240.3 g/mol. IUPAC name: 5-phenylsulfanyl-2,3-dihydroinden-1-one. InChIKey: OVSDZQOMGKFABY-UHFFFAOYSA-N.
| Molecular formula | C15H12OS |
|---|---|
| Molecular weight | 240.3 g/mol |
| IUPAC name | 5-phenylsulfanyl-2,3-dihydroinden-1-one |
| InChIKey | OVSDZQOMGKFABY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=C(C=C2)SC3=CC=CC=C3 |
Computed by PubChem (NCBI)