CAS 1858224-26-6 appears in our catalog under these names: H–D–Aha–OH hydrochloride, H-D-Aha-OH*HCl, H-D-Aha-OH (hydrochloride), 98%, 98%, H-D-Aha-OH (hydrochloride), 98.0%. Offered by: GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 1g, 5g, 250mg, 500mg, 5mg.
(2R)-2-amino-4-azidobutanoic acid;hydrochloride (CAS 1858224-26-6) is a chemical compound with the molecular formula C4H9ClN4O2 and a molecular weight of 180.59 g/mol. IUPAC name: (2R)-2-amino-4-azidobutanoic acid;hydrochloride. InChIKey: MHHYJRIDKLZZEO-AENDTGMFSA-N.
| Molecular formula | C4H9ClN4O2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | (2R)-2-amino-4-azidobutanoic acid;hydrochloride |
| InChIKey | MHHYJRIDKLZZEO-AENDTGMFSA-N |
| SMILES | C(CN=[N+]=[N-])[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)