CAS 2737202-68-3 appears in our catalog under these names: H-Abu(3-N3)-OH*HCl (2S,3S), (2S,3S)-H-Abu(3-N3)-OH (hydrochloride). Offered by: Iris Biotech, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g, Get quote.
(2S,3S)-2-amino-3-azidobutanoic acid;hydrochloride (CAS 2737202-68-3) is a chemical compound with the molecular formula C4H9ClN4O2 and a molecular weight of 180.59 g/mol. IUPAC name: (2S,3S)-2-amino-3-azidobutanoic acid;hydrochloride. InChIKey: MWINUACJIVWJPZ-GVOALSEPSA-N.
| Molecular formula | C4H9ClN4O2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-azidobutanoic acid;hydrochloride |
| InChIKey | MWINUACJIVWJPZ-GVOALSEPSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)N)N=[N+]=[N-].Cl |
Computed by PubChem (NCBI)