Products 1858249-95-2

CAS 1858249-95-2 is the registry number for N-(4-tert-Butylphenyl)-n-(methylsulfonyl)glycine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-tert-butyl-N-methylsulfonylanilino)acetic acid (CAS 1858249-95-2) is a chemical compound with the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. IUPAC name: 2-(4-tert-butyl-N-methylsulfonylanilino)acetic acid. InChIKey: HMKWURIRFCNOJV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19NO4S
Molecular weight285.36 g/mol
IUPAC name2-(4-tert-butyl-N-methylsulfonylanilino)acetic acid
InChIKeyHMKWURIRFCNOJV-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC=C(C=C1)N(CC(=O)O)S(=O)(=O)C

Computed by PubChem (NCBI)