Products 1858250-38-0
CAS 1858250-38-0 is the registry number for [2-(3-Bromophenyl)tetrahydro-2h-pyran-4-yl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2S,4R)-2-(3-bromophenyl)oxan-4-amine (CAS 1858250-38-0) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: (2S,4R)-2-(3-bromophenyl)oxan-4-amine. InChIKey: WDMKSHMULLGORP-MNOVXSKESA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | (2S,4R)-2-(3-bromophenyl)oxan-4-amine |
| InChIKey | WDMKSHMULLGORP-MNOVXSKESA-N |
| SMILES | C1CO[C@@H](C[C@@H]1N)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)