CAS 1858255-09-0 appears in our catalog under these names: 1-[(2,4-Dichlorobenzyl)sulfonyl]piperidine-4-carboxylic acid, 95%, 1-((2,4-DIchlorobenzyl)sulfonyl)piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-[(2,4-dichlorophenyl)methylsulfonyl]piperidine-4-carboxylic acid (CAS 1858255-09-0) is a chemical compound with the molecular formula C13H15Cl2NO4S and a molecular weight of 352.2 g/mol. IUPAC name: 1-[(2,4-dichlorophenyl)methylsulfonyl]piperidine-4-carboxylic acid. InChIKey: SPPJKQWFHDUAMW-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2NO4S |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | 1-[(2,4-dichlorophenyl)methylsulfonyl]piperidine-4-carboxylic acid |
| InChIKey | SPPJKQWFHDUAMW-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)S(=O)(=O)CC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)