Products 885268-92-8
CAS 885268-92-8 is the registry number for 1–((2,6–Dichlorophenyl)sulfonamido)cyclohexane–1–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 50mg.
1-[(2,6-dichlorophenyl)sulfonylamino]cyclohexane-1-carboxylic acid (CAS 885268-92-8) is a chemical compound with the molecular formula C13H15Cl2NO4S and a molecular weight of 352.2 g/mol. IUPAC name: 1-[(2,6-dichlorophenyl)sulfonylamino]cyclohexane-1-carboxylic acid. InChIKey: NUUZGHWSDNRONM-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2NO4S |
|---|---|
| Molecular weight | 352.2 g/mol |
| IUPAC name | 1-[(2,6-dichlorophenyl)sulfonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | NUUZGHWSDNRONM-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C(=O)O)NS(=O)(=O)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)