CAS 18583-55-6 appears in our catalog under these names: (2-Chlorobenzyl)triphenylphosphonium chloride, 96%, (2–Chlorobenzyl)triphenylphosphonium Chloride, (2-Chlorobenzyl)triphenylphosphonium Chloride, >98.0%(HPLC), (2-Chlorobenzyl)triphenylphosphonium Chloride, 98%, 98%, (2-Chlorobenzyl)triphenylphosphonium chloride, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 10g.
(2-chlorophenyl)methyl-triphenylphosphanium chloride (CAS 18583-55-6) is a chemical compound with the molecular formula C25H21Cl2P and a molecular weight of 423.3 g/mol. IUPAC name: (2-chlorophenyl)methyl-triphenylphosphanium chloride. InChIKey: VRAAQIWOSHYDHE-UHFFFAOYSA-M.
| Molecular formula | C25H21Cl2P |
|---|---|
| Molecular weight | 423.3 g/mol |
| IUPAC name | (2-chlorophenyl)methyl-triphenylphosphanium chloride |
| InChIKey | VRAAQIWOSHYDHE-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CC2=CC=CC=C2Cl)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)