CAS 32597-92-5 is the registry number for 3-chlorobenzyl-triphenylphosphonium chloride, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
(3-chlorophenyl)methyl-triphenylphosphanium chloride (CAS 32597-92-5) is a chemical compound with the molecular formula C25H21Cl2P and a molecular weight of 423.3 g/mol. IUPAC name: (3-chlorophenyl)methyl-triphenylphosphanium chloride. InChIKey: ULAJKKKOVRAGOQ-UHFFFAOYSA-M.
| Molecular formula | C25H21Cl2P |
|---|---|
| Molecular weight | 423.3 g/mol |
| IUPAC name | (3-chlorophenyl)methyl-triphenylphosphanium chloride |
| InChIKey | ULAJKKKOVRAGOQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CC2=CC(=CC=C2)Cl)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)