Products 185845-89-0
CAS 185845-89-0 is the registry number for Pterodontic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(2R,4aR,8S)-4a,8-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]prop-2-enoic acid (CAS 185845-89-0) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: 2-[(2R,4aR,8S)-4a,8-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]prop-2-enoic acid. InChIKey: PHYJIMYAZBSQFJ-JVLSTEMRSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | 2-[(2R,4aR,8S)-4a,8-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]prop-2-enoic acid |
| InChIKey | PHYJIMYAZBSQFJ-JVLSTEMRSA-N |
| SMILES | C[C@H]1CCC[C@]2(C1=C[C@@H](CC2)C(=C)C(=O)O)C |
Computed by PubChem (NCBI)