CAS 1859988-99-0 appears in our catalog under these names: Sodium 2,3-dihydro-1-benzofuran-5-sulfinate 95%, Sodium 2,3-dihydro-1-benzofuran-5-sulfinate, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Sodium 2,3-dihydro-1-benzofuran-5-sulfinate (CAS 1859988-99-0) is a chemical compound with the molecular formula C8H7NaO3S and a molecular weight of 206.20 g/mol. IUPAC name: sodium 2,3-dihydro-1-benzofuran-5-sulfinate. InChIKey: PCCKONVRKJWSDK-UHFFFAOYSA-M.
| Molecular formula | C8H7NaO3S |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | sodium 2,3-dihydro-1-benzofuran-5-sulfinate |
| InChIKey | PCCKONVRKJWSDK-UHFFFAOYSA-M |
| SMILES | C1COC2=C1C=C(C=C2)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)