CAS 2039-44-3 appears in our catalog under these names: Beta-styrenesulfonic acid sodium salt, 95%, Sodium β–Styrenesulfonate, Sodium beta-Styrenesulfonate, >95.0%(T), Sodium ²-Styrenesulfonate, Sodium 2-phenylethenesulfonate, ≥95%, ≥95%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Chemat. Available pack sizes: 1g, 5g, 200mg.
Sodium (E)-2-phenylethenesulfonate (CAS 2039-44-3) is a chemical compound with the molecular formula C8H7NaO3S and a molecular weight of 206.20 g/mol. IUPAC name: sodium (E)-2-phenylethenesulfonate. InChIKey: MNCGMVDMOKPCSQ-UHDJGPCESA-M.
| Molecular formula | C8H7NaO3S |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | sodium (E)-2-phenylethenesulfonate |
| InChIKey | MNCGMVDMOKPCSQ-UHDJGPCESA-M |
| SMILES | C1=CC=C(C=C1)/C=C/S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)