Products 1860-58-8
CAS 1860-58-8 appears in our catalog under these names: 3-Benzyloxyphenylacetic Acid, >98.0%(T), (3-Benzyloxyphenyl)acetic acid, 2-(3-(Benzyloxy)phenyl)acetic acid, 98%. Offered by: TCI, Biosynth, Fluorochem. Available pack sizes: 1g, 2g, 5g, 10g, 25g.
2-(3-phenylmethoxyphenyl)acetic acid (CAS 1860-58-8) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-(3-phenylmethoxyphenyl)acetic acid. InChIKey: LLZKAZNUCYYBQO-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-(3-phenylmethoxyphenyl)acetic acid |
| InChIKey | LLZKAZNUCYYBQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-Benzyloxyphenyl)acetic acid, 2-(3-(Benzyloxy)phenyl)acetic acid, 3-Benzyloxyphenylacetic acid, 2-(3-phenylmethoxyphenyl)acetic Acid, (3-Benzyloxy-phenyl)-acetic acid, [3-(benzyloxy)phenyl]acetic acid, 2-[3-(benzyloxy)phenyl]acetic acid, 2-[3-(phenylmethoxy)phenyl]acetic acid, 2-(3-benzyloxyphenyl)acetic acid, 2-(3-(Benzyloxy)phenyl)aceticacid