Products 1860033-52-8

CAS 1860033-52-8 is the registry number for 2-Azetidinecarboxylic acid, 1-(2-fluoroethyl)-,methyl ester, (2s)-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl (2S)-1-(2-fluoroethyl)azetidine-2-carboxylate (CAS 1860033-52-8) is a chemical compound with the molecular formula C7H12FNO2 and a molecular weight of 161.17 g/mol. IUPAC name: methyl (2S)-1-(2-fluoroethyl)azetidine-2-carboxylate. InChIKey: MWJBLNRWWBKFAL-LURJTMIESA-N.

Identity
Molecular formulaC7H12FNO2
Molecular weight161.17 g/mol
IUPAC namemethyl (2S)-1-(2-fluoroethyl)azetidine-2-carboxylate
InChIKeyMWJBLNRWWBKFAL-LURJTMIESA-N
SMILESCOC(=O)[C@@H]1CCN1CCF

Computed by PubChem (NCBI)