CAS 2165612-32-6 is the registry number for Ethyl (2R,4R)-4-fluoropyrrolidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2R,4R)-4-fluoropyrrolidine-2-carboxylate (CAS 2165612-32-6) is a chemical compound with the molecular formula C7H12FNO2 and a molecular weight of 161.17 g/mol. IUPAC name: ethyl (2R,4R)-4-fluoropyrrolidine-2-carboxylate. InChIKey: YRDIYVDGPRPFPX-PHDIDXHHSA-N.
| Molecular formula | C7H12FNO2 |
|---|---|
| Molecular weight | 161.17 g/mol |
| IUPAC name | ethyl (2R,4R)-4-fluoropyrrolidine-2-carboxylate |
| InChIKey | YRDIYVDGPRPFPX-PHDIDXHHSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@H](CN1)F |
Computed by PubChem (NCBI)