Products 1860067-54-4

CAS 1860067-54-4 is the registry number for 2-Azetidinecarboxylic acid, 1,3-dimethyl, (2s)-, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2S)-1,3-dimethylazetidine-2-carboxylic acid (CAS 1860067-54-4) is a chemical compound with the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. IUPAC name: (2S)-1,3-dimethylazetidine-2-carboxylic acid. InChIKey: BCJSJTVMZBUSRL-AKGZTFGVSA-N.

Identity
Molecular formulaC6H11NO2
Molecular weight129.16 g/mol
IUPAC name(2S)-1,3-dimethylazetidine-2-carboxylic acid
InChIKeyBCJSJTVMZBUSRL-AKGZTFGVSA-N
SMILESCC1CN([C@@H]1C(=O)O)C

Computed by PubChem (NCBI)