CAS 2725774-11-6 appears in our catalog under these names: (2S,3R)-1,3-Dimethylazetidine-2-carboxylic acid, 98%, (2S,3R)-1,3-Dimethylazetidine-2-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
(2S,3R)-1,3-dimethylazetidine-2-carboxylic acid (CAS 2725774-11-6) is a chemical compound with the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. IUPAC name: (2S,3R)-1,3-dimethylazetidine-2-carboxylic acid. InChIKey: BCJSJTVMZBUSRL-UHNVWZDZSA-N.
| Molecular formula | C6H11NO2 |
|---|---|
| Molecular weight | 129.16 g/mol |
| IUPAC name | (2S,3R)-1,3-dimethylazetidine-2-carboxylic acid |
| InChIKey | BCJSJTVMZBUSRL-UHNVWZDZSA-N |
| SMILES | C[C@@H]1CN([C@@H]1C(=O)O)C |
Computed by PubChem (NCBI)