CAS 18603-33-3 is the registry number for 2,6-Dichloro-4-methylpyridine-3,5-dicarbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dichloro-4-methylpyridine-3,5-dicarbonitrile (CAS 18603-33-3) is a chemical compound with the molecular formula C8H3Cl2N3 and a molecular weight of 212.03 g/mol. IUPAC name: 2,6-dichloro-4-methylpyridine-3,5-dicarbonitrile. InChIKey: UQIRWMYHOMSYGS-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2N3 |
|---|---|
| Molecular weight | 212.03 g/mol |
| IUPAC name | 2,6-dichloro-4-methylpyridine-3,5-dicarbonitrile |
| InChIKey | UQIRWMYHOMSYGS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1C#N)Cl)Cl)C#N |
Computed by PubChem (NCBI)