Products 2833706-56-0
CAS 2833706-56-0 is the registry number for 5,7-Dichloroimidazo[1,2-a]pyridine-3-carbonitrile, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5,7-dichloroimidazo[1,2-a]pyridine-3-carbonitrile (CAS 2833706-56-0) is a chemical compound with the molecular formula C8H3Cl2N3 and a molecular weight of 212.03 g/mol. IUPAC name: 5,7-dichloroimidazo[1,2-a]pyridine-3-carbonitrile. InChIKey: GGWJBFWCCQAKBL-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2N3 |
|---|---|
| Molecular weight | 212.03 g/mol |
| IUPAC name | 5,7-dichloroimidazo[1,2-a]pyridine-3-carbonitrile |
| InChIKey | GGWJBFWCCQAKBL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N2C1=NC=C2C#N)Cl)Cl |
Computed by PubChem (NCBI)