CAS 1862265-45-9 appears in our catalog under these names: 4-Bromo-N'-hydroxythiophene-3-carboximidamide, 95%, 4-Bromo-N'-hydroxythiophene-3-carboximidamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-bromo-N'-hydroxythiophene-3-carboximidamide (CAS 1862265-45-9) is a chemical compound with the molecular formula C5H5BrN2OS and a molecular weight of 221.08 g/mol. IUPAC name: 4-bromo-N'-hydroxythiophene-3-carboximidamide. InChIKey: COIWZBYBUMKHKS-UHFFFAOYSA-N.
| Molecular formula | C5H5BrN2OS |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 4-bromo-N'-hydroxythiophene-3-carboximidamide |
| InChIKey | COIWZBYBUMKHKS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CS1)Br)/C(=N/O)/N |
Computed by PubChem (NCBI)