Products 1863087-69-7
CAS 1863087-69-7 is the registry number for 4-Bromo-3-chloro-2-fluorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
4-bromo-3-chloro-2-fluorobenzamide (CAS 1863087-69-7) is a chemical compound with the molecular formula C7H4BrClFNO and a molecular weight of 252.47 g/mol. IUPAC name: 4-bromo-3-chloro-2-fluorobenzamide. InChIKey: GEJJFJMNHYCFFR-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClFNO |
|---|---|
| Molecular weight | 252.47 g/mol |
| IUPAC name | 4-bromo-3-chloro-2-fluorobenzamide |
| InChIKey | GEJJFJMNHYCFFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)N)F)Cl)Br |
Computed by PubChem (NCBI)