Products 2387488-66-4
CAS 2387488-66-4 is the registry number for 3-Bromo-2-chloro-6-fluorobenzaldehyde oxime, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(NE)-N-[(3-bromo-2-chloro-6-fluorophenyl)methylidene]hydroxylamine (CAS 2387488-66-4) is a chemical compound with the molecular formula C7H4BrClFNO and a molecular weight of 252.47 g/mol. IUPAC name: (NE)-N-[(3-bromo-2-chloro-6-fluorophenyl)methylidene]hydroxylamine. InChIKey: VBABTBGPWLGTBV-QDEBKDIKSA-N.
| Molecular formula | C7H4BrClFNO |
|---|---|
| Molecular weight | 252.47 g/mol |
| IUPAC name | (NE)-N-[(3-bromo-2-chloro-6-fluorophenyl)methylidene]hydroxylamine |
| InChIKey | VBABTBGPWLGTBV-QDEBKDIKSA-N |
| SMILES | C1=CC(=C(C(=C1F)/C=N/O)Cl)Br |
Computed by PubChem (NCBI)