Products 1863117-91-2
CAS 1863117-91-2 appears in our catalog under these names: Photo–lysine (Photo lysine), Photo-lysine. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, Get quote.
(2S)-2-amino-3-[3-(2-aminoethyl)diazirin-3-yl]propanoic acid (CAS 1863117-91-2) is a chemical compound with the molecular formula C6H12N4O2 and a molecular weight of 172.19 g/mol. IUPAC name: (2S)-2-amino-3-[3-(2-aminoethyl)diazirin-3-yl]propanoic acid. InChIKey: CQTOOIGELCPQPJ-BYPYZUCNSA-N.
| Molecular formula | C6H12N4O2 |
|---|---|
| Molecular weight | 172.19 g/mol |
| IUPAC name | (2S)-2-amino-3-[3-(2-aminoethyl)diazirin-3-yl]propanoic acid |
| InChIKey | CQTOOIGELCPQPJ-BYPYZUCNSA-N |
| SMILES | C(CN)C1(N=N1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)