CAS 21209-39-2 is the registry number for (alphaS,5R)-alpha,2-Diamino-4,5-dihydro-1H-imidazole-5 Propanoic Acid. Offered by: TRC. Available pack sizes: 1g.
(2S)-2-amino-3-[(5R)-2-amino-4,5-dihydro-1H-imidazol-5-yl]propanoic acid (CAS 21209-39-2) is a chemical compound with the molecular formula C6H12N4O2 and a molecular weight of 172.19 g/mol. IUPAC name: (2S)-2-amino-3-[(5R)-2-amino-4,5-dihydro-1H-imidazol-5-yl]propanoic acid. InChIKey: VFXRPXBQCNHQRQ-DMTCNVIQSA-N.
| Molecular formula | C6H12N4O2 |
|---|---|
| Molecular weight | 172.19 g/mol |
| IUPAC name | (2S)-2-amino-3-[(5R)-2-amino-4,5-dihydro-1H-imidazol-5-yl]propanoic acid |
| InChIKey | VFXRPXBQCNHQRQ-DMTCNVIQSA-N |
| SMILES | C1[C@H](NC(=N1)N)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)