Products 186343-35-1
CAS 186343-35-1 appears in our catalog under these names: (5S)-5-phenyl-1,3-oxazolidin-2-one, 97%, 97%, (S)-5-Phenyloxazolidin-2-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(5S)-5-phenyl-1,3-oxazolidin-2-one (CAS 186343-35-1) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (5S)-5-phenyl-1,3-oxazolidin-2-one. InChIKey: ARILQDNHZGKJBK-MRVPVSSYSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (5S)-5-phenyl-1,3-oxazolidin-2-one |
| InChIKey | ARILQDNHZGKJBK-MRVPVSSYSA-N |
| SMILES | C1[C@@H](OC(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
(5S)-5-phenyl-1,3-oxazolidin-2-one