Products 186374-63-0
CAS 186374-63-0 is the registry number for Enantio-7(11)-eudesmen-4-ol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
(1S,4aS,8aS)-1,4a-dimethyl-7-propan-2-ylidene-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-ol (CAS 186374-63-0) is a chemical compound with the molecular formula C15H26O and a molecular weight of 222.37 g/mol. IUPAC name: (1S,4aS,8aS)-1,4a-dimethyl-7-propan-2-ylidene-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-ol. InChIKey: STRABSCAWZINIF-KKUMJFAQSA-N.
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | (1S,4aS,8aS)-1,4a-dimethyl-7-propan-2-ylidene-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-ol |
| InChIKey | STRABSCAWZINIF-KKUMJFAQSA-N |
| SMILES | CC(=C1CC[C@@]2(CCC[C@]([C@H]2C1)(C)O)C)C |
Computed by PubChem (NCBI)