Products 473-04-1
CAS 473-04-1 appears in our catalog under these names: (+)-Juniper Camphor, (+)-Juniper Camphor, ≥98%, ≥98%, Juniper camphor. Offered by: TRC, Chemat, MedChemExpress. Available pack sizes: 25mg, 5mg, Get quote.
(1R,4aR,8aR)-1,4a-dimethyl-7-propan-2-ylidene-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-ol (CAS 473-04-1) is a chemical compound with the molecular formula C15H26O and a molecular weight of 222.37 g/mol. IUPAC name: (1R,4aR,8aR)-1,4a-dimethyl-7-propan-2-ylidene-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-ol. InChIKey: STRABSCAWZINIF-RBSFLKMASA-N.
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | (1R,4aR,8aR)-1,4a-dimethyl-7-propan-2-ylidene-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-ol |
| InChIKey | STRABSCAWZINIF-RBSFLKMASA-N |
| SMILES | CC(=C1CC[C@]2(CCC[C@@]([C@@H]2C1)(C)O)C)C |
Computed by PubChem (NCBI)