CAS 186386-90-3 is the registry number for 4-Fluoro-2-(2,2,2-trifluoroethoxy)aniline. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-fluoro-2-(2,2,2-trifluoroethoxy)aniline (CAS 186386-90-3) is a chemical compound with the molecular formula C8H7F4NO and a molecular weight of 209.14 g/mol. IUPAC name: 4-fluoro-2-(2,2,2-trifluoroethoxy)aniline. InChIKey: KTJBWMIVXDHCNT-UHFFFAOYSA-N.
| Molecular formula | C8H7F4NO |
|---|---|
| Molecular weight | 209.14 g/mol |
| IUPAC name | 4-fluoro-2-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | KTJBWMIVXDHCNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)OCC(F)(F)F)N |
Computed by PubChem (NCBI)