Products 186387-87-1

CAS 186387-87-1 is the registry number for Ethyl N-((2Z)-2-cyano-2-(ethoxymethylidene)acetyl)carbamate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl N-[(Z)-2-cyano-3-ethoxyprop-2-enoyl]carbamate (CAS 186387-87-1) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: ethyl N-[(Z)-2-cyano-3-ethoxyprop-2-enoyl]carbamate. InChIKey: JNZGHWBZWCEXEJ-SREVYHEPSA-N.

Identity
Molecular formulaC9H12N2O4
Molecular weight212.20 g/mol
IUPAC nameethyl N-[(Z)-2-cyano-3-ethoxyprop-2-enoyl]carbamate
InChIKeyJNZGHWBZWCEXEJ-SREVYHEPSA-N
SMILESCCO/C=C(/C#N)\C(=O)NC(=O)OCC

Computed by PubChem (NCBI)