CAS 186392-43-8 appears in our catalog under these names: CP-316819, CP-316819/ 98.01% (existing batch purity), CP 316819, CP 316819, CP 316,819, 98.01% ,, 98.01% ,. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 10mg, 1mg, 5mg, 2mg, 50mg, 25mg, 50 mg, 10 mg.
5-chloro-N-[(2S,3R)-3-hydroxy-4-[methoxy(methyl)amino]-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide (CAS 186392-43-8) is a chemical compound with the molecular formula C21H22ClN3O4 and a molecular weight of 415.9 g/mol. IUPAC name: 5-chloro-N-[(2S,3R)-3-hydroxy-4-[methoxy(methyl)amino]-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide. InChIKey: WEQLRDLTRCEUHG-PKOBYXMFSA-N.
| Molecular formula | C21H22ClN3O4 |
|---|---|
| Molecular weight | 415.9 g/mol |
| IUPAC name | 5-chloro-N-[(2S,3R)-3-hydroxy-4-[methoxy(methyl)amino]-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide |
| InChIKey | WEQLRDLTRCEUHG-PKOBYXMFSA-N |
| SMILES | CN(C(=O)[C@@H]([C@H](CC1=CC=CC=C1)NC(=O)C2=CC3=C(N2)C=CC(=C3)Cl)O)OC |
Computed by PubChem (NCBI)