Products 2734078-85-2
CAS 2734078-85-2 is the registry number for Chlorpheniramine Nitrile Maleate. Offered by: TRC. Available pack sizes: 500mg.
(Z)-but-2-enedioic acid;2-(4-chlorophenyl)-4-(dimethylamino)-2-pyridin-2-ylbutanenitrile (CAS 2734078-85-2) is a chemical compound with the molecular formula C21H22ClN3O4 and a molecular weight of 415.9 g/mol. IUPAC name: (Z)-but-2-enedioic acid;2-(4-chlorophenyl)-4-(dimethylamino)-2-pyridin-2-ylbutanenitrile. InChIKey: CGKYKNAKCDDUMM-BTJKTKAUSA-N.
| Molecular formula | C21H22ClN3O4 |
|---|---|
| Molecular weight | 415.9 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;2-(4-chlorophenyl)-4-(dimethylamino)-2-pyridin-2-ylbutanenitrile |
| InChIKey | CGKYKNAKCDDUMM-BTJKTKAUSA-N |
| SMILES | CN(C)CCC(C#N)(C1=CC=C(C=C1)Cl)C2=CC=CC=N2.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)