Products 1864003-55-3
CAS 1864003-55-3 appears in our catalog under these names: Rac-(8s,8as)-octahydro-8-indolizinamine dihydrochloride, 95%, Rac-(8S,8aS)-octahydro-8-indolizinamine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
(8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-amine;dihydrochloride (CAS 1864003-55-3) is a chemical compound with the molecular formula C8H18Cl2N2 and a molecular weight of 213.15 g/mol. IUPAC name: (8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-amine;dihydrochloride. InChIKey: FOZMFJQVCFPRQH-FOMWZSOGSA-N.
| Molecular formula | C8H18Cl2N2 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | (8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-amine;dihydrochloride |
| InChIKey | FOZMFJQVCFPRQH-FOMWZSOGSA-N |
| SMILES | C1C[C@@H]([C@@H]2CCCN2C1)N.Cl.Cl |
Computed by PubChem (NCBI)