CAS 2230901-08-1 appears in our catalog under these names: (3R,8Ar)-3-methyloctahydropyrrolo[1,2-a]pyrazine dihydrochloride, 95%, (3R,8AR)-3-methyloctahydropyrrolo(1,2-a)pyrazine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
(3R,8aR)-3-methyl-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine;dihydrochloride (CAS 2230901-08-1) is a chemical compound with the molecular formula C8H18Cl2N2 and a molecular weight of 213.15 g/mol. IUPAC name: (3R,8aR)-3-methyl-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine;dihydrochloride. InChIKey: MTKCZUPDFLIFRL-RHJRFJOKSA-N.
| Molecular formula | C8H18Cl2N2 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | (3R,8aR)-3-methyl-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine;dihydrochloride |
| InChIKey | MTKCZUPDFLIFRL-RHJRFJOKSA-N |
| SMILES | C[C@@H]1CN2CCC[C@@H]2CN1.Cl.Cl |
Computed by PubChem (NCBI)