CAS 1864014-61-8 is the registry number for Cyclobutyl(2,3-dihydrobenzofuran-5-yl)methanamine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclobutyl(2,3-dihydro-1-benzofuran-5-yl)methanamine;hydrochloride (CAS 1864014-61-8) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: cyclobutyl(2,3-dihydro-1-benzofuran-5-yl)methanamine;hydrochloride. InChIKey: KGTMGCLLELLQEE-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | cyclobutyl(2,3-dihydro-1-benzofuran-5-yl)methanamine;hydrochloride |
| InChIKey | KGTMGCLLELLQEE-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(C2=CC3=C(C=C2)OCC3)N.Cl |
Computed by PubChem (NCBI)