CAS 1864014-68-5 is the registry number for 1-(3-Iodophenyl)-1H-1,2,3-triazole. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(3-iodophenyl)triazole (CAS 1864014-68-5) is a chemical compound with the molecular formula C8H6IN3 and a molecular weight of 271.06 g/mol. IUPAC name: 1-(3-iodophenyl)triazole. InChIKey: JIGOIJDJRMQQPT-UHFFFAOYSA-N.
| Molecular formula | C8H6IN3 |
|---|---|
| Molecular weight | 271.06 g/mol |
| IUPAC name | 1-(3-iodophenyl)triazole |
| InChIKey | JIGOIJDJRMQQPT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)I)N2C=CN=N2 |
Computed by PubChem (NCBI)