CAS 1864015-33-7 is the registry number for Potassium 5-methyl-1,3,4-thiadiazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Potassium 5-methyl-1,3,4-thiadiazole-2-carboxylate (CAS 1864015-33-7) is a chemical compound with the molecular formula C4H3KN2O2S and a molecular weight of 182.24 g/mol. IUPAC name: potassium 5-methyl-1,3,4-thiadiazole-2-carboxylate. InChIKey: POUFPTLBFFPOEG-UHFFFAOYSA-M.
| Molecular formula | C4H3KN2O2S |
|---|---|
| Molecular weight | 182.24 g/mol |
| IUPAC name | potassium 5-methyl-1,3,4-thiadiazole-2-carboxylate |
| InChIKey | POUFPTLBFFPOEG-UHFFFAOYSA-M |
| SMILES | CC1=NN=C(S1)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)