CAS 2413886-11-8 is the registry number for 3-Methyl-1,2,4-thiadiazole-5-carboxylate potassium. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg.
Potassium 3-methyl-1,2,4-thiadiazole-5-carboxylate (CAS 2413886-11-8) is a chemical compound with the molecular formula C4H3KN2O2S and a molecular weight of 182.24 g/mol. IUPAC name: potassium 3-methyl-1,2,4-thiadiazole-5-carboxylate. InChIKey: ALIQUJMFNXBXOP-UHFFFAOYSA-M.
| Molecular formula | C4H3KN2O2S |
|---|---|
| Molecular weight | 182.24 g/mol |
| IUPAC name | potassium 3-methyl-1,2,4-thiadiazole-5-carboxylate |
| InChIKey | ALIQUJMFNXBXOP-UHFFFAOYSA-M |
| SMILES | CC1=NSC(=N1)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)