CAS 1864015-38-2 is the registry number for (1-Methyl-1H-pyrazol-4-yl)(1,2,4-oxadiazol-3-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1-methylpyrazol-4-yl)-(1,2,4-oxadiazol-3-yl)methanamine;dihydrochloride (CAS 1864015-38-2) is a chemical compound with the molecular formula C7H11Cl2N5O and a molecular weight of 252.10 g/mol. IUPAC name: (1-methylpyrazol-4-yl)-(1,2,4-oxadiazol-3-yl)methanamine;dihydrochloride. InChIKey: VHXINNXNYRXCDU-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2N5O |
|---|---|
| Molecular weight | 252.10 g/mol |
| IUPAC name | (1-methylpyrazol-4-yl)-(1,2,4-oxadiazol-3-yl)methanamine;dihydrochloride |
| InChIKey | VHXINNXNYRXCDU-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C(C2=NOC=N2)N.Cl.Cl |
Computed by PubChem (NCBI)