CAS 2089258-76-2 is the registry number for 3-(1-Aminoethyl)-7H,8H-(1,2,4)triazolo(4,3-a)pyrazin-8-one dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(1-aminoethyl)-7H-[1,2,4]triazolo[4,3-a]pyrazin-8-one;dihydrochloride (CAS 2089258-76-2) is a chemical compound with the molecular formula C7H11Cl2N5O and a molecular weight of 252.10 g/mol. IUPAC name: 3-(1-aminoethyl)-7H-[1,2,4]triazolo[4,3-a]pyrazin-8-one;dihydrochloride. InChIKey: HTUIQLHJHJTNTI-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2N5O |
|---|---|
| Molecular weight | 252.10 g/mol |
| IUPAC name | 3-(1-aminoethyl)-7H-[1,2,4]triazolo[4,3-a]pyrazin-8-one;dihydrochloride |
| InChIKey | HTUIQLHJHJTNTI-UHFFFAOYSA-N |
| SMILES | CC(C1=NN=C2N1C=CNC2=O)N.Cl.Cl |
Computed by PubChem (NCBI)