Products 1864270-64-3

CAS 1864270-64-3 is the registry number for tert-butyl N-(1-(methylamino)propan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[1-(methylamino)propan-2-yl]carbamate (CAS 1864270-64-3) is a chemical compound with the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. IUPAC name: tert-butyl N-[1-(methylamino)propan-2-yl]carbamate. InChIKey: LKEWKAVKGVXBTD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H20N2O2
Molecular weight188.27 g/mol
IUPAC nametert-butyl N-[1-(methylamino)propan-2-yl]carbamate
InChIKeyLKEWKAVKGVXBTD-UHFFFAOYSA-N
SMILESCC(CNC)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)