Products 873221-70-6

CAS 873221-70-6 is the registry number for tert-Butyl N-((2S)-1-(methylamino)propan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 2,5g, 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(2S)-1-(methylamino)propan-2-yl]carbamate (CAS 873221-70-6) is a chemical compound with the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. IUPAC name: tert-butyl N-[(2S)-1-(methylamino)propan-2-yl]carbamate. InChIKey: LKEWKAVKGVXBTD-ZETCQYMHSA-N.

Identity
Molecular formulaC9H20N2O2
Molecular weight188.27 g/mol
IUPAC nametert-butyl N-[(2S)-1-(methylamino)propan-2-yl]carbamate
InChIKeyLKEWKAVKGVXBTD-ZETCQYMHSA-N
SMILESC[C@@H](CNC)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)