CAS 873221-70-6 is the registry number for tert-Butyl N-((2S)-1-(methylamino)propan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 2,5g, 1g, 5g.
Tert-butyl N-[(2S)-1-(methylamino)propan-2-yl]carbamate (CAS 873221-70-6) is a chemical compound with the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. IUPAC name: tert-butyl N-[(2S)-1-(methylamino)propan-2-yl]carbamate. InChIKey: LKEWKAVKGVXBTD-ZETCQYMHSA-N.
| Molecular formula | C9H20N2O2 |
|---|---|
| Molecular weight | 188.27 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-(methylamino)propan-2-yl]carbamate |
| InChIKey | LKEWKAVKGVXBTD-ZETCQYMHSA-N |
| SMILES | C[C@@H](CNC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)