Products 186430-23-9
CAS 186430-23-9 appears in our catalog under these names: CP320626, CP-320626, 98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 50 mg, 25 mg, 1 mg, 10 mg, 5 mg, 1mg, 5mg, 10mg.
5-chloro-N-[(2S)-3-(4-fluorophenyl)-1-(4-hydroxypiperidin-1-yl)-1-oxopropan-2-yl]-1H-indole-2-carboxamide (CAS 186430-23-9) is a chemical compound with the molecular formula C23H23ClFN3O3 and a molecular weight of 443.9 g/mol. IUPAC name: 5-chloro-N-[(2S)-3-(4-fluorophenyl)-1-(4-hydroxypiperidin-1-yl)-1-oxopropan-2-yl]-1H-indole-2-carboxamide. InChIKey: YDCGVASFVACWKF-NRFANRHFSA-N.
| Molecular formula | C23H23ClFN3O3 |
|---|---|
| Molecular weight | 443.9 g/mol |
| IUPAC name | 5-chloro-N-[(2S)-3-(4-fluorophenyl)-1-(4-hydroxypiperidin-1-yl)-1-oxopropan-2-yl]-1H-indole-2-carboxamide |
| InChIKey | YDCGVASFVACWKF-NRFANRHFSA-N |
| SMILES | C1CN(CCC1O)C(=O)[C@H](CC2=CC=C(C=C2)F)NC(=O)C3=CC4=C(N3)C=CC(=C4)Cl |
Computed by PubChem (NCBI)