Products 2984963-50-8
CAS 2984963-50-8 appears in our catalog under these names: Sovesudil hydrochloride, Sovesudil (hydrochloride), 99.45%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 5 mg, 10mM/1mL, 10 mg, 50 mg, 100 mg, 25 mg.
Propyl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate;hydrochloride (CAS 2984963-50-8) is a chemical compound with the molecular formula C23H23ClFN3O3 and a molecular weight of 443.9 g/mol. IUPAC name: propyl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate;hydrochloride. InChIKey: XHOTYNSTYWPINR-UHFFFAOYSA-N.
| Molecular formula | C23H23ClFN3O3 |
|---|---|
| Molecular weight | 443.9 g/mol |
| IUPAC name | propyl 3-[2-(aminomethyl)-5-[(3-fluoro-4-pyridinyl)carbamoyl]phenyl]benzoate;hydrochloride |
| InChIKey | XHOTYNSTYWPINR-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=CC=CC(=C1)C2=C(C=CC(=C2)C(=O)NC3=C(C=NC=C3)F)CN.Cl |
Computed by PubChem (NCBI)
Synonyms:
Sovesudil (hydrochloride), Sovesudil hydrochloride