CAS 1864546-73-5 is the registry number for 3-((1-Methyl-1H-pyrazol-4-yl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothietan-3-yl)-1-methylpyrazol-4-amine (CAS 1864546-73-5) is a chemical compound with the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. IUPAC name: N-(1,1-dioxothietan-3-yl)-1-methylpyrazol-4-amine. InChIKey: UXCLVFRGPRYKEL-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O2S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | N-(1,1-dioxothietan-3-yl)-1-methylpyrazol-4-amine |
| InChIKey | UXCLVFRGPRYKEL-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)NC2CS(=O)(=O)C2 |
Computed by PubChem (NCBI)