Products 905810-51-7

CAS 905810-51-7 is the registry number for [(5-Isopropyl-4h-1,2,4-triazol-3-yl)thio]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetic acid (CAS 905810-51-7) is a chemical compound with the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. IUPAC name: 2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetic acid. InChIKey: VDIOBBLMXDLMPH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11N3O2S
Molecular weight201.25 g/mol
IUPAC name2-[(5-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]acetic acid
InChIKeyVDIOBBLMXDLMPH-UHFFFAOYSA-N
SMILESCC(C)C1=NC(=NN1)SCC(=O)O

Computed by PubChem (NCBI)