Products 1864735-93-2
CAS 1864735-93-2 is the registry number for 4-(Azetidin-1-yl)-3-fluorobenzaldehyde, 95%. Offered by: Ambeed. Available pack sizes: 1g.
4-(azetidin-1-yl)-3-fluorobenzaldehyde (CAS 1864735-93-2) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: 4-(azetidin-1-yl)-3-fluorobenzaldehyde. InChIKey: UUDNUFMFJKBJNQ-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 4-(azetidin-1-yl)-3-fluorobenzaldehyde |
| InChIKey | UUDNUFMFJKBJNQ-UHFFFAOYSA-N |
| SMILES | C1CN(C1)C2=C(C=C(C=C2)C=O)F |
Computed by PubChem (NCBI)