CAS 186689-07-6 appears in our catalog under these names: 2-NBDG, 2-NBDG/ min. 98%, 2–NBDG, 2–NBG–1, 2-NBDG, >95.0%(HPLC). Offered by: TRC, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 1mg, 2,5mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanal (CAS 186689-07-6) is a chemical compound with the molecular formula C12H14N4O8 and a molecular weight of 342.26 g/mol. IUPAC name: (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanal. InChIKey: QUTFFEUUGHUPQC-ILWYWAAHSA-N.
| Molecular formula | C12H14N4O8 |
|---|---|
| Molecular weight | 342.26 g/mol |
| IUPAC name | (2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanal |
| InChIKey | QUTFFEUUGHUPQC-ILWYWAAHSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)[N+](=O)[O-])N[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)