CAS 940961-04-6 appears in our catalog under these names: NBD-Fructose, NBD–Fructose, NBD-Fructose, 99.7%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 500μg, 1 mg, 500 μg.
(3S,4R,5R)-3,4,5,6-tetrahydroxy-1-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexan-2-one (CAS 940961-04-6) is a chemical compound with the molecular formula C12H14N4O8 and a molecular weight of 342.26 g/mol. IUPAC name: (3S,4R,5R)-3,4,5,6-tetrahydroxy-1-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexan-2-one. InChIKey: PYUWRKIMILVYHE-GGZOMVNGSA-N.
| Molecular formula | C12H14N4O8 |
|---|---|
| Molecular weight | 342.26 g/mol |
| IUPAC name | (3S,4R,5R)-3,4,5,6-tetrahydroxy-1-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexan-2-one |
| InChIKey | PYUWRKIMILVYHE-GGZOMVNGSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)[N+](=O)[O-])NCC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)