CAS 1866995-24-5 is the registry number for N-(2,2-Dimethylthietan-3-yl)thiophene-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,2-dimethylthietan-3-yl)thiophene-2-carboxamide (CAS 1866995-24-5) is a chemical compound with the molecular formula C10H13NOS2 and a molecular weight of 227.4 g/mol. IUPAC name: N-(2,2-dimethylthietan-3-yl)thiophene-2-carboxamide. InChIKey: CXXPZUULILMWFP-UHFFFAOYSA-N.
| Molecular formula | C10H13NOS2 |
|---|---|
| Molecular weight | 227.4 g/mol |
| IUPAC name | N-(2,2-dimethylthietan-3-yl)thiophene-2-carboxamide |
| InChIKey | CXXPZUULILMWFP-UHFFFAOYSA-N |
| SMILES | CC1(C(CS1)NC(=O)C2=CC=CS2)C |
Computed by PubChem (NCBI)